C11H6F2OS — CID 43160742
(2,4-difluorophenyl)-thiophen-2-ylmethanone (PubChem CID 43160742) has the molecular formula C11H6F2OS and a molecular weight of 224.23 g/mol. Its IUPAC name is (2,4-difluorophenyl)-thiophen-2-ylmethanone.
| Compound Name | (2,4-difluorophenyl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 43160742 |
| Molecular Formula | C11H6F2OS |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | (2,4-difluorophenyl)-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H6F2OS/c12-7-3-4-8(9(13)6-7)11(14)10-2-1-5-15-10/h1-6H |
| InChIKey | NNEMCZCYBATJBI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |