C15H10FN3O2S2 — CID 59733091
1-[5-fluoro-2-(thiophene-2-carbonyl)phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 59733091) has the molecular formula C15H10FN3O2S2 and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-[5-fluoro-2-(thiophene-2-carbonyl)phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[5-fluoro-2-(thiophene-2-carbonyl)phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 59733091 |
| Molecular Formula | C15H10FN3O2S2 |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-[5-fluoro-2-(thiophene-2-carbonyl)phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)Nc1cc(F)ccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C15H10FN3O2S2/c16-9-3-4-10(13(20)12-2-1-6-22-12)11(8-9)18-14(21)19-15-17-5-7-23-15/h1-8H,(H2,17,18,19,21) |
| InChIKey | DWTHIXXVXDOKEZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |