2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid

C11H8FN3O3S — CID 61187315

IUPAC2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid
SMILESO=C(Nc1nccs1)Nc1cccc(F)c1C(=O)O
InChIInChI=1S/C11H8FN3O3S/c12-6-2-1-3-7(8(6)9(16)17)14-10(18)15-11-13-4-5-19-11/h1-5H,(H,16,17)(H2,13,14,15,18)
InChIKeyWDQJPRCGXJZRAA-UHFFFAOYSA-N
MW281.27 g/mol
LogP2.62
Rot. Bonds3

About 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid

2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid (PubChem CID 61187315) has the molecular formula C11H8FN3O3S and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid.

Molecular Properties

Compound Name2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid
PubChem CID61187315
Molecular FormulaC11H8FN3O3S
Molecular Weight281.27 g/mol
Exact Mass281.03
IUPAC Name2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid
SMILESO=C(Nc1nccs1)Nc1cccc(F)c1C(=O)O
InChIInChI=1S/C11H8FN3O3S/c12-6-2-1-3-7(8(6)9(16)17)14-10(18)15-11-13-4-5-19-11/h1-5H,(H,16,17)(H2,13,14,15,18)
InChIKeyWDQJPRCGXJZRAA-UHFFFAOYSA-N
XLogP2.62
TPSA91.32 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.27
LogP ≤ 52.62
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid?
The IUPAC name of 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid (CID 61187315) is 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid.
What is the SMILES notation for 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid?
The canonical SMILES for 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid is O=C(Nc1nccs1)Nc1cccc(F)c1C(=O)O.
What is the InChIKey of 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid?
The InChIKey is WDQJPRCGXJZRAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN3O3S/c12-6-2-1-3-7(8(6)9(16)17)14-10(18)15-11-13-4-5-19-11/h1-5H,(H,16,17)(H2,13,14,15,18).
What are the key properties of 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid?
2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid has a molecular weight of 281.27 g/mol, XLogP of 2.62, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(1,3-thiazol-2-ylcarbamoylamino)benzoic acid is sourced from PubChem (CID 61187315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).