C12H10FN3O4 — CID 106421055
2-fluoro-6-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid (PubChem CID 106421055) has the molecular formula C12H10FN3O4 and a molecular weight of 279.23 g/mol. Its IUPAC name is 2-fluoro-6-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-fluoro-6-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106421055 |
| Molecular Formula | C12H10FN3O4 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-fluoro-6-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccno1)Nc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C12H10FN3O4/c13-8-2-1-3-9(10(8)11(17)18)16-12(19)14-6-7-4-5-15-20-7/h1-5H,6H2,(H,17,18)(H2,14,16,19) |
| InChIKey | YQHNFKOPXOLKJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |