C13H13N3O5 — CID 106421198
4-methoxy-3-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid (PubChem CID 106421198) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-methoxy-3-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 4-methoxy-3-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106421198 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-methoxy-3-(1,2-oxazol-5-ylmethylcarbamoylamino)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)NCc1ccno1 |
| InChI | InChI=1S/C13H13N3O5/c1-20-11-3-2-8(12(17)18)6-10(11)16-13(19)14-7-9-4-5-15-21-9/h2-6H,7H2,1H3,(H,17,18)(H2,14,16,19) |
| InChIKey | WTQFEOSAVDTJOH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |