C12H12N2O3S — CID 63743799
4-methoxy-3-(1,3-thiazol-2-ylmethylamino)benzoic acid (PubChem CID 63743799) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 4-methoxy-3-(1,3-thiazol-2-ylmethylamino)benzoic acid.
| Compound Name | 4-methoxy-3-(1,3-thiazol-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 63743799 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-methoxy-3-(1,3-thiazol-2-ylmethylamino)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NCc1nccs1 |
| InChI | InChI=1S/C12H12N2O3S/c1-17-10-3-2-8(12(15)16)6-9(10)14-7-11-13-4-5-18-11/h2-6,14H,7H2,1H3,(H,15,16) |
| InChIKey | PGIZAXVOZZWSKB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |