C13H12N2O5S — CID 79737424
4-methoxy-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]benzoic acid (PubChem CID 79737424) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-methoxy-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]benzoic acid.
| Compound Name | 4-methoxy-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 79737424 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 4-methoxy-3-[2-oxo-2-(1,3-thiazol-2-ylamino)ethoxy]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H12N2O5S/c1-19-9-3-2-8(12(17)18)6-10(9)20-7-11(16)15-13-14-4-5-21-13/h2-6H,7H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | HFBFNKHNPJEAQS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |