C12H13NO7 — CID 79726833
4-methoxy-3-[2-(methoxycarbonylamino)-2-oxoethoxy]benzoic acid (PubChem CID 79726833) has the molecular formula C12H13NO7 and a molecular weight of 283.24 g/mol. Its IUPAC name is 4-methoxy-3-[2-(methoxycarbonylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 4-methoxy-3-[2-(methoxycarbonylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 79726833 |
| Molecular Formula | C12H13NO7 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-methoxy-3-[2-(methoxycarbonylamino)-2-oxoethoxy]benzoic acid |
| SMILES | COC(=O)NC(=O)COc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C12H13NO7/c1-18-8-4-3-7(11(15)16)5-9(8)20-6-10(14)13-12(17)19-2/h3-5H,6H2,1-2H3,(H,15,16)(H,13,14,17) |
| InChIKey | HKXPGHGGZFKZIF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |