C16H18N2O5S — CID 46924909
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3,4-diethoxybenzoate (PubChem CID 46924909) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 46924909 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2nccs2)cc1OCC |
| InChI | InChI=1S/C16H18N2O5S/c1-3-21-12-6-5-11(9-13(12)22-4-2)15(20)23-10-14(19)18-16-17-7-8-24-16/h5-9H,3-4,10H2,1-2H3,(H,17,18,19) |
| InChIKey | CVCVTAQEUKJJGT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |