C18H20N2O6S — CID 2561770
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 2561770) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 2561770 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2sccc2C(N)=O)cc1OCC |
| InChI | InChI=1S/C18H20N2O6S/c1-3-24-13-6-5-11(9-14(13)25-4-2)18(23)26-10-15(21)20-17-12(16(19)22)7-8-27-17/h5-9H,3-4,10H2,1-2H3,(H2,19,22)(H,20,21) |
| InChIKey | BRQFCNDKZMYZGB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |