C19H19Cl2NO5 — CID 7381928
[2-(2,6-dichloroanilino)-2-oxoethyl] 3,4-diethoxybenzoate (PubChem CID 7381928) has the molecular formula C19H19Cl2NO5 and a molecular weight of 412.27 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 3,4-diethoxybenzoate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3,4-diethoxybenzoate |
|---|---|
| PubChem CID | 7381928 |
| Molecular Formula | C19H19Cl2NO5 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)Nc2c(Cl)cccc2Cl)cc1OCC |
| InChI | InChI=1S/C19H19Cl2NO5/c1-3-25-15-9-8-12(10-16(15)26-4-2)19(24)27-11-17(23)22-18-13(20)6-5-7-14(18)21/h5-10H,3-4,11H2,1-2H3,(H,22,23) |
| InChIKey | PWDFRRUIBJZBLM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |