C16H14Cl2N2O4 — CID 2359410
[2-(2,6-dichloroanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 2359410) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 2359410 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [2-(2,6-dichloroanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H14Cl2N2O4/c1-2-23-15-10(5-4-8-19-15)16(22)24-9-13(21)20-14-11(17)6-3-7-12(14)18/h3-8H,2,9H2,1H3,(H,20,21) |
| InChIKey | BLTVXXVWBFGUGB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |