C17H17IN2O4 — CID 2344631
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 2344631) has the molecular formula C17H17IN2O4 and a molecular weight of 440.24 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 2344631 |
| Molecular Formula | C17H17IN2O4 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)Nc1ccc(I)cc1C |
| InChI | InChI=1S/C17H17IN2O4/c1-3-23-16-13(5-4-8-19-16)17(22)24-10-15(21)20-14-7-6-12(18)9-11(14)2/h4-9H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | ZAZNQZJFVXGUDK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|