C17H16N2O5 — CID 7998156
(2-benzamido-2-oxoethyl) 2-ethoxypyridine-3-carboxylate (PubChem CID 7998156) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 2-ethoxypyridine-3-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 7998156 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O5/c1-2-23-16-13(9-6-10-18-16)17(22)24-11-14(20)19-15(21)12-7-4-3-5-8-12/h3-10H,2,11H2,1H3,(H,19,20,21) |
| InChIKey | WBUKMDBZYSJICV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |