C16H17N3O6S — CID 2497740
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 2497740) has the molecular formula C16H17N3O6S and a molecular weight of 379.39 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 2497740 |
| Molecular Formula | C16H17N3O6S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17N3O6S/c1-2-24-15-13(4-3-9-18-15)16(21)25-10-14(20)19-11-5-7-12(8-6-11)26(17,22)23/h3-9H,2,10H2,1H3,(H,19,20)(H2,17,22,23) |
| InChIKey | LESZUOQUWPNIDL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |