C17H14ClF3N2O4 — CID 55315049
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 55315049) has the molecular formula C17H14ClF3N2O4 and a molecular weight of 402.76 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 55315049 |
| Molecular Formula | C17H14ClF3N2O4 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C17H14ClF3N2O4/c1-2-26-15-10(5-4-8-22-15)16(25)27-9-13(24)23-14-11(17(19,20)21)6-3-7-12(14)18/h3-8H,2,9H2,1H3,(H,23,24) |
| InChIKey | MUIMPQFNLPJCDI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |