C16H9Cl2F3N2O5 — CID 3659043
[2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-chloro-5-nitrobenzoate (PubChem CID 3659043) has the molecular formula C16H9Cl2F3N2O5 and a molecular weight of 437.16 g/mol. Its IUPAC name is [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-chloro-5-nitrobenzoate.
| Compound Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 3659043 |
| Molecular Formula | C16H9Cl2F3N2O5 |
| Molecular Weight | 437.16 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | [2-[2-chloro-6-(trifluoromethyl)anilino]-2-oxoethyl] 2-chloro-5-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc([N+](=O)[O-])ccc1Cl)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H9Cl2F3N2O5/c17-11-5-4-8(23(26)27)6-9(11)15(25)28-7-13(24)22-14-10(16(19,20)21)2-1-3-12(14)18/h1-6H,7H2,(H,22,24) |
| InChIKey | SKERIGIVZFHAGE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|