C16H12ClF3N2O4 — CID 38698880
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxypyridine-3-carboxylate (PubChem CID 38698880) has the molecular formula C16H12ClF3N2O4 and a molecular weight of 388.73 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxypyridine-3-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 38698880 |
| Molecular Formula | C16H12ClF3N2O4 |
| Molecular Weight | 388.73 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-methoxypyridine-3-carboxylate |
| SMILES | COc1ncccc1C(=O)OCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H12ClF3N2O4/c1-25-14-10(3-2-6-21-14)15(24)26-8-13(23)22-12-5-4-9(17)7-11(12)16(18,19)20/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | FRUQISPMGSJGDG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |