C17H17ClN2O6S — CID 7994120
[2-(4-ethoxyanilino)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 7994120) has the molecular formula C17H17ClN2O6S and a molecular weight of 412.85 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7994120 |
| Molecular Formula | C17H17ClN2O6S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(S(N)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2O6S/c1-2-25-12-5-3-11(4-6-12)20-16(21)10-26-17(22)14-9-13(27(19,23)24)7-8-15(14)18/h3-9H,2,10H2,1H3,(H,20,21)(H2,19,23,24) |
| InChIKey | PULMRBXMTFEPHN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |