C17H14ClF2NO6S — CID 2502558
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2502558) has the molecular formula C17H14ClF2NO6S and a molecular weight of 433.82 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2502558 |
| Molecular Formula | C17H14ClF2NO6S |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C17H14ClF2NO6S/c1-28(24,25)12-6-7-14(18)13(8-12)16(23)26-9-15(22)21-10-2-4-11(5-3-10)27-17(19)20/h2-8,17H,9H2,1H3,(H,21,22) |
| InChIKey | RXJWVNGQUSIPAW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |