C16H16N2O6S — CID 2608578
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 2608578) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 2608578 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H16N2O6S/c1-22-11-4-2-3-5-12(11)23-9-14(20)24-8-13(19)18-16-10(15(17)21)6-7-25-16/h2-7H,8-9H2,1H3,(H2,17,21)(H,18,19) |
| InChIKey | NADMMVCWIZOJPQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |