C17H18N2O5S — CID 3905587
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-phenoxybutanoate (PubChem CID 3905587) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-phenoxybutanoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 3905587 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-phenoxybutanoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C17H18N2O5S/c18-16(22)13-8-10-25-17(13)19-14(20)11-24-15(21)7-4-9-23-12-5-2-1-3-6-12/h1-3,5-6,8,10H,4,7,9,11H2,(H2,18,22)(H,19,20) |
| InChIKey | HZFIHVHKYQYUAH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|