C14H11IN2O4S — CID 3513023
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-iodobenzoate (PubChem CID 3513023) has the molecular formula C14H11IN2O4S and a molecular weight of 430.22 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 3513023 |
| Molecular Formula | C14H11IN2O4S |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 429.95 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 4-iodobenzoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11IN2O4S/c15-9-3-1-8(2-4-9)14(20)21-7-11(18)17-13-10(12(16)19)5-6-22-13/h1-6H,7H2,(H2,16,19)(H,17,18) |
| InChIKey | KAHPMYPMKQVTOZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|