C14H10BrClN2O4S — CID 16524597
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 16524597) has the molecular formula C14H10BrClN2O4S and a molecular weight of 417.67 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 16524597 |
| Molecular Formula | C14H10BrClN2O4S |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C14H10BrClN2O4S/c15-7-1-2-10(16)9(5-7)14(21)22-6-11(19)18-13-8(12(17)20)3-4-23-13/h1-5H,6H2,(H2,17,20)(H,18,19) |
| InChIKey | QPBPGEBCHMTKTO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |