C13H10Br2N2O3S — CID 2475511
2-[[2-(2,4-dibromophenoxy)acetyl]amino]thiophene-3-carboxamide (PubChem CID 2475511) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is 2-[[2-(2,4-dibromophenoxy)acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(2,4-dibromophenoxy)acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2475511 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | 2-[[2-(2,4-dibromophenoxy)acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H10Br2N2O3S/c14-7-1-2-10(9(15)5-7)20-6-11(18)17-13-8(12(16)19)3-4-21-13/h1-5H,6H2,(H2,16,19)(H,17,18) |
| InChIKey | GLLBNOCENNRYSJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |