C10H9Br2NO5 — CID 60668042
2-[[2-(2,4-dibromophenoxy)acetyl]amino]oxyacetic acid (PubChem CID 60668042) has the molecular formula C10H9Br2NO5 and a molecular weight of 382.99 g/mol. Its IUPAC name is 2-[[2-(2,4-dibromophenoxy)acetyl]amino]oxyacetic acid.
| Compound Name | 2-[[2-(2,4-dibromophenoxy)acetyl]amino]oxyacetic acid |
|---|---|
| PubChem CID | 60668042 |
| Molecular Formula | C10H9Br2NO5 |
| Molecular Weight | 382.99 g/mol |
| Exact Mass | 380.88 |
| IUPAC Name | 2-[[2-(2,4-dibromophenoxy)acetyl]amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)COc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H9Br2NO5/c11-6-1-2-8(7(12)3-6)17-4-9(14)13-18-5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | CQMMTTMGRBRQMR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.99 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|