C8H8BrNO5S — CID 43164345
2-(2-bromo-4-sulfamoylphenoxy)acetic acid (PubChem CID 43164345) has the molecular formula C8H8BrNO5S and a molecular weight of 310.13 g/mol. Its IUPAC name is 2-(2-bromo-4-sulfamoylphenoxy)acetic acid.
| Compound Name | 2-(2-bromo-4-sulfamoylphenoxy)acetic acid |
|---|---|
| PubChem CID | 43164345 |
| Molecular Formula | C8H8BrNO5S |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | 2-(2-bromo-4-sulfamoylphenoxy)acetic acid |
| SMILES | NS(=O)(=O)c1ccc(OCC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C8H8BrNO5S/c9-6-3-5(16(10,13)14)1-2-7(6)15-4-8(11)12/h1-3H,4H2,(H,11,12)(H2,10,13,14) |
| InChIKey | VVEBGFVMTURSSL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |