C13H10BrF2NO3S — CID 82916878
3-bromo-4-[(3,4-difluorophenyl)methoxy]benzenesulfonamide (PubChem CID 82916878) has the molecular formula C13H10BrF2NO3S and a molecular weight of 378.19 g/mol. Its IUPAC name is 3-bromo-4-[(3,4-difluorophenyl)methoxy]benzenesulfonamide.
| Compound Name | 3-bromo-4-[(3,4-difluorophenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82916878 |
| Molecular Formula | C13H10BrF2NO3S |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 3-bromo-4-[(3,4-difluorophenyl)methoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCc2ccc(F)c(F)c2)c(Br)c1 |
| InChI | InChI=1S/C13H10BrF2NO3S/c14-10-6-9(21(17,18)19)2-4-13(10)20-7-8-1-3-11(15)12(16)5-8/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | BBNUCAOFENYEDR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |