C13H11F2NO3S — CID 43342382
3-fluoro-4-[(3-fluorophenyl)methoxy]benzenesulfonamide (PubChem CID 43342382) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-fluoro-4-[(3-fluorophenyl)methoxy]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[(3-fluorophenyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 43342382 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-fluoro-4-[(3-fluorophenyl)methoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCc2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H11F2NO3S/c14-10-3-1-2-9(6-10)8-19-13-5-4-11(7-12(13)15)20(16,17)18/h1-7H,8H2,(H2,16,17,18) |
| InChIKey | GOMMBUQBSJVGRG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |