C13H13FN2O4S — CID 82913722
3-fluoro-4-[(6-methoxy-2-pyridinyl)methoxy]benzenesulfonamide (PubChem CID 82913722) has the molecular formula C13H13FN2O4S and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-fluoro-4-[(6-methoxy-2-pyridinyl)methoxy]benzenesulfonamide.
| Compound Name | 3-fluoro-4-[(6-methoxy-2-pyridinyl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82913722 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-fluoro-4-[(6-methoxy-2-pyridinyl)methoxy]benzenesulfonamide |
| SMILES | COc1cccc(COc2ccc(S(N)(=O)=O)cc2F)n1 |
| InChI | InChI=1S/C13H13FN2O4S/c1-19-13-4-2-3-9(16-13)8-20-12-6-5-10(7-11(12)14)21(15,17)18/h2-7H,8H2,1H3,(H2,15,17,18) |
| InChIKey | BGBUMPLHOLQFCR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |