C15H16BrNO3S — CID 43342283
3-bromo-4-(3-phenylpropoxy)benzenesulfonamide (PubChem CID 43342283) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-bromo-4-(3-phenylpropoxy)benzenesulfonamide.
| Compound Name | 3-bromo-4-(3-phenylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43342283 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-bromo-4-(3-phenylpropoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrNO3S/c16-14-11-13(21(17,18)19)8-9-15(14)20-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11H,4,7,10H2,(H2,17,18,19) |
| InChIKey | KQCPAVKMEDDXEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|