C16H17BrO2 — CID 63051637
[3-bromo-4-(3-phenylpropoxy)phenyl]methanol (PubChem CID 63051637) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is [3-bromo-4-(3-phenylpropoxy)phenyl]methanol.
| Compound Name | [3-bromo-4-(3-phenylpropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 63051637 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | [3-bromo-4-(3-phenylpropoxy)phenyl]methanol |
| SMILES | OCc1ccc(OCCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C16H17BrO2/c17-15-11-14(12-18)8-9-16(15)19-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,18H,4,7,10,12H2 |
| InChIKey | JSOMRJJTYIFGAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|