C16H17ClO2 — CID 43324882
[5-chloro-2-(3-phenylpropoxy)phenyl]methanol (PubChem CID 43324882) has the molecular formula C16H17ClO2 and a molecular weight of 276.76 g/mol. Its IUPAC name is [5-chloro-2-(3-phenylpropoxy)phenyl]methanol.
| Compound Name | [5-chloro-2-(3-phenylpropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 43324882 |
| Molecular Formula | C16H17ClO2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | [5-chloro-2-(3-phenylpropoxy)phenyl]methanol |
| SMILES | OCc1cc(Cl)ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C16H17ClO2/c17-15-8-9-16(14(11-15)12-18)19-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,18H,4,7,10,12H2 |
| InChIKey | JDMRVLXQMXAGBL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|