C20H17ClO4 — CID 15604735
5-[[5-chloro-2-(2-phenylethoxy)phenyl]methyl]furan-2-carboxylic acid (PubChem CID 15604735) has the molecular formula C20H17ClO4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 5-[[5-chloro-2-(2-phenylethoxy)phenyl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[5-chloro-2-(2-phenylethoxy)phenyl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 15604735 |
| Molecular Formula | C20H17ClO4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 5-[[5-chloro-2-(2-phenylethoxy)phenyl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cc2cc(Cl)ccc2OCCc2ccccc2)o1 |
| InChI | InChI=1S/C20H17ClO4/c21-16-6-8-18(24-11-10-14-4-2-1-3-5-14)15(12-16)13-17-7-9-19(25-17)20(22)23/h1-9,12H,10-11,13H2,(H,22,23) |
| InChIKey | YLUMCFYIIDICFY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |