C19H11ClF3NaO4 — CID 23667798
sodium 5-[[5-chloro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate (PubChem CID 23667798) has the molecular formula C19H11ClF3NaO4 and a molecular weight of 418.73 g/mol. Its IUPAC name is sodium 5-[[5-chloro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate.
| Compound Name | sodium 5-[[5-chloro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 23667798 |
| Molecular Formula | C19H11ClF3NaO4 |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | sodium 5-[[5-chloro-2-[(3,4,5-trifluorophenyl)methoxy]phenyl]methyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(Cc2cc(Cl)ccc2OCc2cc(F)c(F)c(F)c2)o1.[Na+] |
| InChI | InChI=1S/C19H12ClF3O4.Na/c20-12-1-3-16(26-9-10-5-14(21)18(23)15(22)6-10)11(7-12)8-13-2-4-17(27-13)19(24)25;/h1-7H,8-9H2,(H,24,25);/q;+1/p-1 |
| InChIKey | ZQFDWJISJIQWSS-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|