C20H26ClNO3 — CID 15605115
N-tert-butyl-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]furan-2-carboxamide (PubChem CID 15605115) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is N-tert-butyl-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]furan-2-carboxamide.
| Compound Name | N-tert-butyl-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 15605115 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-tert-butyl-5-[[5-chloro-2-(2-methylpropoxy)phenyl]methyl]furan-2-carboxamide |
| SMILES | CC(C)COc1ccc(Cl)cc1Cc1ccc(C(=O)NC(C)(C)C)o1 |
| InChI | InChI=1S/C20H26ClNO3/c1-13(2)12-24-17-8-6-15(21)10-14(17)11-16-7-9-18(25-16)19(23)22-20(3,4)5/h6-10,13H,11-12H2,1-5H3,(H,22,23) |
| InChIKey | PBMRUEHAFYMASI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |