C25H19ClFNO3 — CID 15605179
5-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide (PubChem CID 15605179) has the molecular formula C25H19ClFNO3 and a molecular weight of 435.88 g/mol. Its IUPAC name is 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 15605179 |
| Molecular Formula | C25H19ClFNO3 |
| Molecular Weight | 435.88 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-[(5-chloro-2-phenylmethoxyphenyl)methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(Cc2cc(Cl)ccc2OCc2ccccc2)o1 |
| InChI | InChI=1S/C25H19ClFNO3/c26-19-10-12-23(30-16-17-6-2-1-3-7-17)18(14-19)15-20-11-13-24(31-20)25(29)28-22-9-5-4-8-21(22)27/h1-14H,15-16H2,(H,28,29) |
| InChIKey | USLIBEQTIFEXSR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.88 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |