C26H22ClFN2O2 — CID 3334338
5-[[benzyl-[(4-chlorophenyl)methyl]amino]methyl]-N-(2-fluorophenyl)furan-2-carboxamide (PubChem CID 3334338) has the molecular formula C26H22ClFN2O2 and a molecular weight of 448.93 g/mol. Its IUPAC name is 5-[[benzyl-[(4-chlorophenyl)methyl]amino]methyl]-N-(2-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[[benzyl-[(4-chlorophenyl)methyl]amino]methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3334338 |
| Molecular Formula | C26H22ClFN2O2 |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 5-[[benzyl-[(4-chlorophenyl)methyl]amino]methyl]-N-(2-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(CN(Cc2ccccc2)Cc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C26H22ClFN2O2/c27-21-12-10-20(11-13-21)17-30(16-19-6-2-1-3-7-19)18-22-14-15-25(32-22)26(31)29-24-9-5-4-8-23(24)28/h1-15H,16-18H2,(H,29,31) |
| InChIKey | KBHPSFSMWUCUNG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |