C28H25F3N2O2 — CID 42753762
N-benzyl-5-[[benzyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]furan-2-carboxamide (PubChem CID 42753762) has the molecular formula C28H25F3N2O2 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-benzyl-5-[[benzyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]furan-2-carboxamide.
| Compound Name | N-benzyl-5-[[benzyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42753762 |
| Molecular Formula | C28H25F3N2O2 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-benzyl-5-[[benzyl-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(CN(Cc2ccccc2)Cc2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C28H25F3N2O2/c29-28(30,31)24-13-11-23(12-14-24)19-33(18-22-9-5-2-6-10-22)20-25-15-16-26(35-25)27(34)32-17-21-7-3-1-4-8-21/h1-16H,17-20H2,(H,32,34) |
| InChIKey | XPRNOISMTVWXOI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |