C29H32F3NO2 — CID 21045842
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide (PubChem CID 21045842) has the molecular formula C29H32F3NO2 and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045842 |
| Molecular Formula | C29H32F3NO2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3ccc(C(F)(F)F)cc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H32F3NO2/c1-18-14-23-24(28(4,5)13-12-27(23,2)3)16-20(18)15-22-10-11-25(35-22)26(34)33-17-19-6-8-21(9-7-19)29(30,31)32/h6-11,14,16H,12-13,15,17H2,1-5H3,(H,33,34) |
| InChIKey | VZLJHXYPFWVKQG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |