C35H39NO4 — CID 21046965
N-[[2-[2-(hydroxymethyl)phenoxy]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046965) has the molecular formula C35H39NO4 and a molecular weight of 537.70 g/mol. Its IUPAC name is N-[[2-[2-(hydroxymethyl)phenoxy]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[2-[2-(hydroxymethyl)phenoxy]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046965 |
| Molecular Formula | C35H39NO4 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | N-[[2-[2-(hydroxymethyl)phenoxy]phenyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3ccccc3Oc3ccccc3CO)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H39NO4/c1-23-18-28-29(35(4,5)17-16-34(28,2)3)20-26(23)19-27-14-15-32(39-27)33(38)36-21-24-10-6-8-12-30(24)40-31-13-9-7-11-25(31)22-37/h6-15,18,20,37H,16-17,19,21-22H2,1-5H3,(H,36,38) |
| InChIKey | SQIBHHNDRWFJRS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |