C43H47NO4 — CID 21046994
N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046994) has the molecular formula C43H47NO4 and a molecular weight of 641.85 g/mol. Its IUPAC name is N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046994 |
| Molecular Formula | C43H47NO4 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCCc3ccc(OCc4ccccc4)c(OCc4ccccc4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C43H47NO4/c1-30-24-36-37(43(4,5)22-21-42(36,2)3)27-34(30)26-35-17-19-39(48-35)41(45)44-23-20-31-16-18-38(46-28-32-12-8-6-9-13-32)40(25-31)47-29-33-14-10-7-11-15-33/h6-19,24-25,27H,20-23,26,28-29H2,1-5H3,(H,44,45) |
| InChIKey | SXHJAWRJGYSZPW-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |