C34H36ClNO3 — CID 21047279
N-[(2-chloro-6-phenoxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047279) has the molecular formula C34H36ClNO3 and a molecular weight of 542.12 g/mol. Its IUPAC name is N-[(2-chloro-6-phenoxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(2-chloro-6-phenoxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047279 |
| Molecular Formula | C34H36ClNO3 |
| Molecular Weight | 542.12 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | N-[(2-chloro-6-phenoxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3c(Cl)cccc3Oc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H36ClNO3/c1-22-18-27-28(34(4,5)17-16-33(27,2)3)20-23(22)19-25-14-15-31(39-25)32(37)36-21-26-29(35)12-9-13-30(26)38-24-10-7-6-8-11-24/h6-15,18,20H,16-17,19,21H2,1-5H3,(H,36,37) |
| InChIKey | UJSGVDJNPBRCNZ-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.12 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |