C35H39NO3 — CID 21045748
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 21045748) has the molecular formula C35H39NO3 and a molecular weight of 521.70 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045748 |
| Molecular Formula | C35H39NO3 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCCc3ccccc3Oc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H39NO3/c1-24-21-29-30(35(4,5)19-18-34(29,2)3)23-26(24)22-28-15-16-32(39-28)33(37)36-20-17-25-11-9-10-14-31(25)38-27-12-7-6-8-13-27/h6-16,21,23H,17-20,22H2,1-5H3,(H,36,37) |
| InChIKey | NRSUYXDBJIWWQI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |