C29H33Cl2NO2 — CID 21046912
N-[2-(2,6-dichlorophenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046912) has the molecular formula C29H33Cl2NO2 and a molecular weight of 498.49 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(2,6-dichlorophenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046912 |
| Molecular Formula | C29H33Cl2NO2 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCCc3c(Cl)cccc3Cl)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H33Cl2NO2/c1-18-15-22-23(29(4,5)13-12-28(22,2)3)17-19(18)16-20-9-10-26(34-20)27(33)32-14-11-21-24(30)7-6-8-25(21)31/h6-10,15,17H,11-14,16H2,1-5H3,(H,32,33) |
| InChIKey | JBYHMBNZPRYUGR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |