C28H28Cl2F3NO2 — CID 21047206
N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047206) has the molecular formula C28H28Cl2F3NO2 and a molecular weight of 538.44 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047206 |
| Molecular Formula | C28H28Cl2F3NO2 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | N-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3c(Cl)cc(C(F)(F)F)cc3Cl)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H28Cl2F3NO2/c1-15-10-19-20(27(4,5)9-8-26(19,2)3)12-16(15)11-18-6-7-23(36-18)25(35)34-24-21(29)13-17(14-22(24)30)28(31,32)33/h6-7,10,12-14H,8-9,11H2,1-5H3,(H,34,35) |
| InChIKey | NLFGRZXIBTVWLK-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |