C33H32F6N4O2 — CID 21047798
N-[4-[3,5-bis(trifluoromethyl)anilino]pyrimidin-2-yl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047798) has the molecular formula C33H32F6N4O2 and a molecular weight of 630.63 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)anilino]pyrimidin-2-yl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)anilino]pyrimidin-2-yl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047798 |
| Molecular Formula | C33H32F6N4O2 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)anilino]pyrimidin-2-yl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3nccc(Nc4cc(C(F)(F)F)cc(C(F)(F)F)c4)n3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C33H32F6N4O2/c1-18-12-24-25(31(4,5)10-9-30(24,2)3)14-19(18)13-23-6-7-26(45-23)28(44)43-29-40-11-8-27(42-29)41-22-16-20(32(34,35)36)15-21(17-22)33(37,38)39/h6-8,11-12,14-17H,9-10,13H2,1-5H3,(H2,40,41,42,43,44) |
| InChIKey | LFKRZNGROZFATO-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |