C28H32F3N3O2 — CID 142842005
N'-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbohydrazide (PubChem CID 142842005) has the molecular formula C28H32F3N3O2 and a molecular weight of 499.58 g/mol. Its IUPAC name is N'-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbohydrazide.
| Compound Name | N'-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 142842005 |
| Molecular Formula | C28H32F3N3O2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | N'-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbohydrazide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NNc3ncc(C(F)(F)F)cc3C)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H32F3N3O2/c1-16-12-21-22(27(5,6)10-9-26(21,3)4)14-18(16)13-20-7-8-23(36-20)25(35)34-33-24-17(2)11-19(15-32-24)28(29,30)31/h7-8,11-12,14-15H,9-10,13H2,1-6H3,(H,32,33)(H,34,35) |
| InChIKey | BWKPIZWWWZMCFC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|