C28H31Cl2NO2 — CID 21047138
N-(2,4-dichloro-6-methylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047138) has the molecular formula C28H31Cl2NO2 and a molecular weight of 484.47 g/mol. Its IUPAC name is N-(2,4-dichloro-6-methylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(2,4-dichloro-6-methylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047138 |
| Molecular Formula | C28H31Cl2NO2 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-(2,4-dichloro-6-methylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3c(C)cc(Cl)cc3Cl)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H31Cl2NO2/c1-16-12-21-22(28(5,6)10-9-27(21,3)4)14-18(16)13-20-7-8-24(33-20)26(32)31-25-17(2)11-19(29)15-23(25)30/h7-8,11-12,14-15H,9-10,13H2,1-6H3,(H,31,32) |
| InChIKey | HWNAMDVCUSRISX-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |