C32H36N2O2 — CID 90754447
N-(4-methyl-5-phenyl-1H-pyrrol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 90754447) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is N-(4-methyl-5-phenyl-1H-pyrrol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(4-methyl-5-phenyl-1H-pyrrol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 90754447 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-(4-methyl-5-phenyl-1H-pyrrol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3cc(C)c(-c4ccccc4)[nH]3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H36N2O2/c1-20-16-25-26(32(5,6)15-14-31(25,3)4)19-23(20)18-24-12-13-27(36-24)30(35)34-28-17-21(2)29(33-28)22-10-8-7-9-11-22/h7-13,16-17,19,33H,14-15,18H2,1-6H3,(H,34,35) |
| InChIKey | UXNMRZMMYTZLPJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |